C14H16O6 — CID 101385492
methyl (1S,4R,4aR,8aR)-4-acetyloxy-1-hydroxy-7-oxo-1,4,8,8a-tetrahydronaphthalene-4a-carboxylate (PubChem CID 101385492) has the molecular formula C14H16O6 and a molecular weight of 280.28 g/mol. Its IUPAC name is methyl (1S,4R,4aR,8aR)-4-acetyloxy-1-hydroxy-7-oxo-1,4,8,8a-tetrahydronaphthalene-4a-carboxylate.
| Compound Name | methyl (1S,4R,4aR,8aR)-4-acetyloxy-1-hydroxy-7-oxo-1,4,8,8a-tetrahydronaphthalene-4a-carboxylate |
|---|---|
| PubChem CID | 101385492 |
| Molecular Formula | C14H16O6 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | methyl (1S,4R,4aR,8aR)-4-acetyloxy-1-hydroxy-7-oxo-1,4,8,8a-tetrahydronaphthalene-4a-carboxylate |
| SMILES | COC(=O)[C@]12C=CC(=O)C[C@H]1[C@@H](O)C=C[C@H]2OC(C)=O |
| InChI | InChI=1S/C14H16O6/c1-8(15)20-12-4-3-11(17)10-7-9(16)5-6-14(10,12)13(18)19-2/h3-6,10-12,17H,7H2,1-2H3/t10-,11-,12+,14+/m0/s1 |
| InChIKey | ATHIJANEMPHBFZ-CIQGVGRVSA-N |
| XLogP | 0.15 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|