C11H14O6 — CID 11096774
methyl (1S,2R,5R,6R)-2-acetyloxy-6-formyl-4-hydroxybicyclo[3.1.0]hexane-1-carboxylate (PubChem CID 11096774) has the molecular formula C11H14O6 and a molecular weight of 242.23 g/mol. Its IUPAC name is methyl (1S,2R,5R,6R)-2-acetyloxy-6-formyl-4-hydroxybicyclo[3.1.0]hexane-1-carboxylate.
| Compound Name | methyl (1S,2R,5R,6R)-2-acetyloxy-6-formyl-4-hydroxybicyclo[3.1.0]hexane-1-carboxylate |
|---|---|
| PubChem CID | 11096774 |
| Molecular Formula | C11H14O6 |
| Molecular Weight | 242.23 g/mol |
| Exact Mass | 242.08 |
| IUPAC Name | methyl (1S,2R,5R,6R)-2-acetyloxy-6-formyl-4-hydroxybicyclo[3.1.0]hexane-1-carboxylate |
| SMILES | COC(=O)[C@]12[C@H](C=O)[C@H]1C(O)C[C@H]2OC(C)=O |
| InChI | InChI=1S/C11H14O6/c1-5(13)17-8-3-7(14)9-6(4-12)11(8,9)10(15)16-2/h4,6-9,14H,3H2,1-2H3/t6-,7?,8-,9+,11+/m1/s1 |
| InChIKey | PCSZIDGOHZKPOJ-CKMQKMTRSA-N |
| XLogP | -0.71 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.23 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|