C9H10O2 — CID 177456125
methyl (1S,2R,4S,5S,6R,7R)-tetracyclo[3.2.0.02,7.04,6]heptane-1-carboxylate (PubChem CID 177456125) has the molecular formula C9H10O2 and a molecular weight of 150.18 g/mol. Its IUPAC name is methyl (1S,2R,4S,5S,6R,7R)-tetracyclo[3.2.0.02,7.04,6]heptane-1-carboxylate.
| Compound Name | methyl (1S,2R,4S,5S,6R,7R)-tetracyclo[3.2.0.02,7.04,6]heptane-1-carboxylate |
|---|---|
| PubChem CID | 177456125 |
| Molecular Formula | C9H10O2 |
| Molecular Weight | 150.18 g/mol |
| Exact Mass | 150.07 |
| IUPAC Name | methyl (1S,2R,4S,5S,6R,7R)-tetracyclo[3.2.0.02,7.04,6]heptane-1-carboxylate |
| SMILES | COC(=O)[C@]12[C@@H]3[C@@H]4[C@H](C[C@H]31)[C@@H]42 |
| InChI | InChI=1S/C9H10O2/c1-11-8(10)9-4-2-3-5(6(3)9)7(4)9/h3-7H,2H2,1H3/t3-,4+,5+,6-,7-,9+/m0/s1 |
| InChIKey | RRAWKWFARWQMQA-RHNOWPELSA-N |
| XLogP | 0.67 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.18 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |