C26H26O5 — CID 71601296
dimethyl (1R,2S,3R,4S,5S,6R,7R,8S,10S)-4-hydroxy-4,5-diphenyltetracyclo[5.2.1.02,6.03,8]decane-7,10-dicarboxylate (PubChem CID 71601296) has the molecular formula C26H26O5 and a molecular weight of 418.49 g/mol. Its IUPAC name is dimethyl (1R,2S,3R,4S,5S,6R,7R,8S,10S)-4-hydroxy-4,5-diphenyltetracyclo[5.2.1.02,6.03,8]decane-7,10-dicarboxylate.
| Compound Name | dimethyl (1R,2S,3R,4S,5S,6R,7R,8S,10S)-4-hydroxy-4,5-diphenyltetracyclo[5.2.1.02,6.03,8]decane-7,10-dicarboxylate |
|---|---|
| PubChem CID | 71601296 |
| Molecular Formula | C26H26O5 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | dimethyl (1R,2S,3R,4S,5S,6R,7R,8S,10S)-4-hydroxy-4,5-diphenyltetracyclo[5.2.1.02,6.03,8]decane-7,10-dicarboxylate |
| SMILES | COC(=O)[C@H]1[C@@H]2C[C@H]3[C@H]4[C@@H]2[C@H]([C@@H](c2ccccc2)[C@]4(O)c2ccccc2)[C@]31C(=O)OC |
| InChI | InChI=1S/C26H26O5/c1-30-23(27)20-16-13-17-21-18(16)22(25(17,20)24(28)31-2)19(14-9-5-3-6-10-14)26(21,29)15-11-7-4-8-12-15/h3-12,16-22,29H,13H2,1-2H3/t16-,17+,18-,19-,20-,21+,22-,25+,26-/m1/s1 |
| InChIKey | LJEDEQKBOBQBDC-SCIRAOCPSA-N |
| XLogP | 3.13 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |