C25H30O4 — CID 135007174
dimethyl (1S,5S,6R)-1-[(1R,4Z,8S)-9-bicyclo[6.1.0]non-4-enyl]-6-phenylbicyclo[3.1.0]hexane-3,3-dicarboxylate (PubChem CID 135007174) has the molecular formula C25H30O4 and a molecular weight of 394.51 g/mol. Its IUPAC name is dimethyl (1S,5S,6R)-1-[(1R,4Z,8S)-9-bicyclo[6.1.0]non-4-enyl]-6-phenylbicyclo[3.1.0]hexane-3,3-dicarboxylate.
| Compound Name | dimethyl (1S,5S,6R)-1-[(1R,4Z,8S)-9-bicyclo[6.1.0]non-4-enyl]-6-phenylbicyclo[3.1.0]hexane-3,3-dicarboxylate |
|---|---|
| PubChem CID | 135007174 |
| Molecular Formula | C25H30O4 |
| Molecular Weight | 394.51 g/mol |
| Exact Mass | 394.21 |
| IUPAC Name | dimethyl (1S,5S,6R)-1-[(1R,4Z,8S)-9-bicyclo[6.1.0]non-4-enyl]-6-phenylbicyclo[3.1.0]hexane-3,3-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)C[C@H]2[C@H](c3ccccc3)[C@@]2(C2[C@H]3CC/C=C\CC[C@@H]23)C1 |
| InChI | InChI=1S/C25H30O4/c1-28-22(26)24(23(27)29-2)14-19-20(16-10-6-5-7-11-16)25(19,15-24)21-17-12-8-3-4-9-13-18(17)21/h3-7,10-11,17-21H,8-9,12-15H2,1-2H3/b4-3-/t17-,18+,19-,20-,21?,25+/m0/s1 |
| InChIKey | ORENZUCGKVZHPM-DGZCHXEPSA-N |
| XLogP | 4.51 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.51 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|