C24H28O7 — CID 102006487
trimethyl (2S,4aR,8aS,9aR)-2-phenyl-2,3,4a,5,6,8,9,9a-octahydrobenzo[f][1]benzofuran-7,7,8a-tricarboxylate (PubChem CID 102006487) has the molecular formula C24H28O7 and a molecular weight of 428.48 g/mol. Its IUPAC name is trimethyl (2S,4aR,8aS,9aR)-2-phenyl-2,3,4a,5,6,8,9,9a-octahydrobenzo[f][1]benzofuran-7,7,8a-tricarboxylate.
| Compound Name | trimethyl (2S,4aR,8aS,9aR)-2-phenyl-2,3,4a,5,6,8,9,9a-octahydrobenzo[f][1]benzofuran-7,7,8a-tricarboxylate |
|---|---|
| PubChem CID | 102006487 |
| Molecular Formula | C24H28O7 |
| Molecular Weight | 428.48 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | trimethyl (2S,4aR,8aS,9aR)-2-phenyl-2,3,4a,5,6,8,9,9a-octahydrobenzo[f][1]benzofuran-7,7,8a-tricarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)CC[C@@H]2C=C3C[C@@H](c4ccccc4)O[C@@H]3C[C@@]2(C(=O)OC)C1 |
| InChI | InChI=1S/C24H28O7/c1-28-20(25)23(21(26)29-2)10-9-17-11-16-12-18(15-7-5-4-6-8-15)31-19(16)13-24(17,14-23)22(27)30-3/h4-8,11,17-19H,9-10,12-14H2,1-3H3/t17-,18+,19-,24-/m1/s1 |
| InChIKey | MYRGUUQBWUCLPL-NRAIQUKZSA-N |
| XLogP | 3.14 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.48 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|