C12H12O3 — CID 10560113
methyl (1S,2R,3S,4R,5S,6S,7R,8R)-9-oxopentacyclo[4.4.0.02,4.03,8.05,7]decane-4-carboxylate (PubChem CID 10560113) has the molecular formula C12H12O3 and a molecular weight of 204.22 g/mol. Its IUPAC name is methyl (1S,2R,3S,4R,5S,6S,7R,8R)-9-oxopentacyclo[4.4.0.02,4.03,8.05,7]decane-4-carboxylate.
| Compound Name | methyl (1S,2R,3S,4R,5S,6S,7R,8R)-9-oxopentacyclo[4.4.0.02,4.03,8.05,7]decane-4-carboxylate |
|---|---|
| PubChem CID | 10560113 |
| Molecular Formula | C12H12O3 |
| Molecular Weight | 204.22 g/mol |
| Exact Mass | 204.08 |
| IUPAC Name | methyl (1S,2R,3S,4R,5S,6S,7R,8R)-9-oxopentacyclo[4.4.0.02,4.03,8.05,7]decane-4-carboxylate |
| SMILES | COC(=O)[C@@]12[C@@H]3[C@@H]4[C@H]5C(=O)C[C@@H]([C@@H]43)[C@@H]1[C@@H]52 |
| InChI | InChI=1S/C12H12O3/c1-15-11(14)12-8-3-2-4(13)6(10(8)12)7-5(3)9(7)12/h3,5-10H,2H2,1H3/t3-,5-,6+,7-,8+,9-,10+,12+/m0/s1 |
| InChIKey | DMMCOIWTCTZPLV-VGSYNYPUSA-N |
| XLogP | 0.49 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.22 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |