C22H24O6 — CID 124794084
dimethyl (1R,2S,3S,4R,5S,9S,10S,13S,14S,18S)-6,15-dioxoheptacyclo[9.7.0.02,13.03,10.04,12.05,9.014,18]octadecane-11,12-dicarboxylate (PubChem CID 124794084) has the molecular formula C22H24O6 and a molecular weight of 384.43 g/mol. Its IUPAC name is dimethyl (1R,2S,3S,4R,5S,9S,10S,13S,14S,18S)-6,15-dioxoheptacyclo[9.7.0.02,13.03,10.04,12.05,9.014,18]octadecane-11,12-dicarboxylate.
| Compound Name | dimethyl (1R,2S,3S,4R,5S,9S,10S,13S,14S,18S)-6,15-dioxoheptacyclo[9.7.0.02,13.03,10.04,12.05,9.014,18]octadecane-11,12-dicarboxylate |
|---|---|
| PubChem CID | 124794084 |
| Molecular Formula | C22H24O6 |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | dimethyl (1R,2S,3S,4R,5S,9S,10S,13S,14S,18S)-6,15-dioxoheptacyclo[9.7.0.02,13.03,10.04,12.05,9.014,18]octadecane-11,12-dicarboxylate |
| SMILES | COC(=O)C12[C@@H]3[C@@H]4CCC(=O)[C@@H]4[C@@H]4[C@H]3[C@H]3[C@@H]1[C@@H]1CCC(=O)[C@@H]1[C@@H]3C42C(=O)OC |
| InChI | InChI=1S/C22H24O6/c1-27-19(25)21-15-7-3-5-9(23)11(7)17-13(15)14-16(21)8-4-6-10(24)12(8)18(14)22(17,21)20(26)28-2/h7-8,11-18H,3-6H2,1-2H3/t7-,8-,11-,12-,13+,14+,15-,16+,17-,18+,21?,22?/m1/s1 |
| InChIKey | ZAUBUEUXPABYLK-RBRMRQRNSA-N |
| XLogP | 1.26 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |