C22H28O6 — CID 124793417
dimethyl (1R,2R,4R,8R,9S,10S,11R,12S,13R,17R)-7,14-dioxopentacyclo[10.6.0.02,9.04,8.013,17]octadecane-10,11-dicarboxylate (PubChem CID 124793417) has the molecular formula C22H28O6 and a molecular weight of 388.46 g/mol. Its IUPAC name is dimethyl (1R,2R,4R,8R,9S,10S,11R,12S,13R,17R)-7,14-dioxopentacyclo[10.6.0.02,9.04,8.013,17]octadecane-10,11-dicarboxylate.
| Compound Name | dimethyl (1R,2R,4R,8R,9S,10S,11R,12S,13R,17R)-7,14-dioxopentacyclo[10.6.0.02,9.04,8.013,17]octadecane-10,11-dicarboxylate |
|---|---|
| PubChem CID | 124793417 |
| Molecular Formula | C22H28O6 |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | dimethyl (1R,2R,4R,8R,9S,10S,11R,12S,13R,17R)-7,14-dioxopentacyclo[10.6.0.02,9.04,8.013,17]octadecane-10,11-dicarboxylate |
| SMILES | COC(=O)[C@@H]1[C@H](C(=O)OC)[C@H]2[C@H](C[C@H]3CCC(=O)[C@H]32)[C@H]2C[C@H]3CCC(=O)[C@H]3[C@H]21 |
| InChI | InChI=1S/C22H28O6/c1-27-21(25)19-17-11(7-9-3-5-13(23)15(9)17)12-8-10-4-6-14(24)16(10)18(12)20(19)22(26)28-2/h9-12,15-20H,3-8H2,1-2H3/t9-,10-,11-,12-,15+,16+,17+,18+,19-,20+/m1/s1 |
| InChIKey | WNYILJTXRAEKHH-DXGHUPJTSA-N |
| XLogP | 2.04 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |