C12H14O3 — CID 23228581
methyl (1S,2S,3S,4S,5S,6R,7S,8R,9R)-9-hydroxypentacyclo[4.4.0.02,4.03,8.05,7]decane-4-carboxylate (PubChem CID 23228581) has the molecular formula C12H14O3 and a molecular weight of 206.24 g/mol. Its IUPAC name is methyl (1S,2S,3S,4S,5S,6R,7S,8R,9R)-9-hydroxypentacyclo[4.4.0.02,4.03,8.05,7]decane-4-carboxylate.
| Compound Name | methyl (1S,2S,3S,4S,5S,6R,7S,8R,9R)-9-hydroxypentacyclo[4.4.0.02,4.03,8.05,7]decane-4-carboxylate |
|---|---|
| PubChem CID | 23228581 |
| Molecular Formula | C12H14O3 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | methyl (1S,2S,3S,4S,5S,6R,7S,8R,9R)-9-hydroxypentacyclo[4.4.0.02,4.03,8.05,7]decane-4-carboxylate |
| SMILES | COC(=O)[C@@]12[C@@H]3[C@@H]4[C@H]3[C@@H]3C[C@@H](O)[C@H]4[C@@H]1[C@H]32 |
| InChI | InChI=1S/C12H14O3/c1-15-11(14)12-8-3-2-4(13)6(10(8)12)7-5(3)9(7)12/h3-10,13H,2H2,1H3/t3-,4+,5+,6+,7+,8-,9-,10+,12-/m0/s1 |
| InChIKey | WSNVFPVAYHVIEM-SYVRJXAZSA-N |
| XLogP | 0.28 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |