C11H9F3O2 — CID 155982311
methyl 4-(trifluoromethyl)cubane-1-carboxylate (PubChem CID 155982311) has the molecular formula C11H9F3O2 and a molecular weight of 230.19 g/mol. Its IUPAC name is methyl 4-(trifluoromethyl)cubane-1-carboxylate.
| Compound Name | methyl 4-(trifluoromethyl)cubane-1-carboxylate |
|---|---|
| PubChem CID | 155982311 |
| Molecular Formula | C11H9F3O2 |
| Molecular Weight | 230.19 g/mol |
| Exact Mass | 230.06 |
| IUPAC Name | methyl 4-(trifluoromethyl)cubane-1-carboxylate |
| SMILES | COC(=O)C12C3C4C1C1C2C3C41C(F)(F)F |
| InChI | InChI=1S/C11H9F3O2/c1-16-8(15)9-2-5-3(9)7-4(9)6(2)10(5,7)11(12,13)14/h2-7H,1H3 |
| InChIKey | VNKZUAXIEZXGSX-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.19 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |