About dimethyl (2S,4R)-tetracyclo[3.2.0.02,7.04,6]heptane-1,6-dicarboxylate
dimethyl (2S,4R)-tetracyclo[3.2.0.02,7.04,6]heptane-1,6-dicarboxylate (PubChem CID 10727053) has the molecular formula C11H12O4
and a molecular weight of 208.21 g/mol. Its IUPAC name is dimethyl (2S,4R)-tetracyclo[3.2.0.02,7.04,6]heptane-1,6-dicarboxylate.
Analyze dimethyl (2S,4R)-tetracyclo[3.2.0.02,7.04,6]heptane-1,6-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl (2S,4R)-tetracyclo[3.2.0.02,7.04,6]heptane-1,6-dicarboxylate?
The IUPAC name of dimethyl (2S,4R)-tetracyclo[3.2.0.02,7.04,6]heptane-1,6-dicarboxylate (CID 10727053) is dimethyl (2S,4R)-tetracyclo[3.2.0.02,7.04,6]heptane-1,6-dicarboxylate.
What is the SMILES notation for dimethyl (2S,4R)-tetracyclo[3.2.0.02,7.04,6]heptane-1,6-dicarboxylate?
The canonical SMILES for dimethyl (2S,4R)-tetracyclo[3.2.0.02,7.04,6]heptane-1,6-dicarboxylate is COC(=O)C12C3[C@H]1C[C@H]1C2C31C(=O)OC.
What is the InChIKey of dimethyl (2S,4R)-tetracyclo[3.2.0.02,7.04,6]heptane-1,6-dicarboxylate?
The InChIKey is RQILZHQQAWIAQJ-MYZGHSTLSA-N. The full InChI is InChI=1S/C11H12O4/c1-14-8(12)10-4-3-5-7(10)11(5,6(4)10)9(13)15-2/h4-7H,3H2,1-2H3/t4-,5+,6?,7?,10?,11?.
What are the key properties of dimethyl (2S,4R)-tetracyclo[3.2.0.02,7.04,6]heptane-1,6-dicarboxylate?
dimethyl (2S,4R)-tetracyclo[3.2.0.02,7.04,6]heptane-1,6-dicarboxylate has a molecular weight of 208.21 g/mol, XLogP of 0.21, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl (2S,4R)-tetracyclo[3.2.0.02,7.04,6]heptane-1,6-dicarboxylate is sourced from PubChem (CID 10727053), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).