C14H16O4 — CID 124763820
dimethyl (1S,2S,3S,4R,5S,6R,7R,8S)-pentacyclo[4.4.0.02,5.03,8.04,7]decane-2,4-dicarboxylate (PubChem CID 124763820) has the molecular formula C14H16O4 and a molecular weight of 248.28 g/mol. Its IUPAC name is dimethyl (1S,2S,3S,4R,5S,6R,7R,8S)-pentacyclo[4.4.0.02,5.03,8.04,7]decane-2,4-dicarboxylate.
| Compound Name | dimethyl (1S,2S,3S,4R,5S,6R,7R,8S)-pentacyclo[4.4.0.02,5.03,8.04,7]decane-2,4-dicarboxylate |
|---|---|
| PubChem CID | 124763820 |
| Molecular Formula | C14H16O4 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | dimethyl (1S,2S,3S,4R,5S,6R,7R,8S)-pentacyclo[4.4.0.02,5.03,8.04,7]decane-2,4-dicarboxylate |
| SMILES | COC(=O)[C@@]12[C@@H]3[C@@H]4CC[C@H]5[C@H]3[C@H]1[C@@]5(C(=O)OC)[C@H]42 |
| InChI | InChI=1S/C14H16O4/c1-17-11(15)13-6-4-3-5-8-7(6)10(13)14(8,9(5)13)12(16)18-2/h5-10H,3-4H2,1-2H3/t5-,6-,7+,8+,9-,10-,13-,14+/m0/s1 |
| InChIKey | HVTTYKUXTVTVRA-PFDBTUGESA-N |
| XLogP | 0.85 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |