C20H24O8 — CID 14786939
tetramethyl tetracyclo[6.4.0.04,12.05,9]dodec-10-ene-9,10,11,12-tetracarboxylate (PubChem CID 14786939) has the molecular formula C20H24O8 and a molecular weight of 392.40 g/mol. Its IUPAC name is tetramethyl tetracyclo[6.4.0.04,12.05,9]dodec-10-ene-9,10,11,12-tetracarboxylate.
| Compound Name | tetramethyl tetracyclo[6.4.0.04,12.05,9]dodec-10-ene-9,10,11,12-tetracarboxylate |
|---|---|
| PubChem CID | 14786939 |
| Molecular Formula | C20H24O8 |
| Molecular Weight | 392.40 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | tetramethyl tetracyclo[6.4.0.04,12.05,9]dodec-10-ene-9,10,11,12-tetracarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)C2(C(=O)OC)C3CCC2C2CCC3C12C(=O)OC |
| InChI | InChI=1S/C20H24O8/c1-25-15(21)13-14(16(22)26-2)20(18(24)28-4)11-7-8-12(20)10-6-5-9(11)19(10,13)17(23)27-3/h9-12H,5-8H2,1-4H3 |
| InChIKey | ALAHITGLNQFEQG-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.40 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|