C14H16O4 — CID 102356416
methyl (1S,4R,8S,9S)-10,12-dioxotricyclo[6.2.2.04,9]dodec-5-ene-9-carboxylate (PubChem CID 102356416) has the molecular formula C14H16O4 and a molecular weight of 248.28 g/mol. Its IUPAC name is methyl (1S,4R,8S,9S)-10,12-dioxotricyclo[6.2.2.04,9]dodec-5-ene-9-carboxylate.
| Compound Name | methyl (1S,4R,8S,9S)-10,12-dioxotricyclo[6.2.2.04,9]dodec-5-ene-9-carboxylate |
|---|---|
| PubChem CID | 102356416 |
| Molecular Formula | C14H16O4 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | methyl (1S,4R,8S,9S)-10,12-dioxotricyclo[6.2.2.04,9]dodec-5-ene-9-carboxylate |
| SMILES | COC(=O)[C@@]12C(=O)[C@H]3CC[C@@H]1C=CC[C@@H]2C(=O)C3 |
| InChI | InChI=1S/C14H16O4/c1-18-13(17)14-9-3-2-4-10(14)11(15)7-8(5-6-9)12(14)16/h2-3,8-10H,4-7H2,1H3/t8-,9-,10+,14-/m0/s1 |
| InChIKey | GFDREUJAMGEAOH-RZGXBDKHSA-N |
| XLogP | 1.29 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|