C19H22O5 — CID 54243925
methyl (1R,5R,8S,12R)-5,8-dimethyl-3,10,13-trioxotetracyclo[10.2.1.02,11.04,9]pentadec-6-ene-4-carboxylate (PubChem CID 54243925) has the molecular formula C19H22O5 and a molecular weight of 330.38 g/mol. Its IUPAC name is methyl (1R,5R,8S,12R)-5,8-dimethyl-3,10,13-trioxotetracyclo[10.2.1.02,11.04,9]pentadec-6-ene-4-carboxylate.
| Compound Name | methyl (1R,5R,8S,12R)-5,8-dimethyl-3,10,13-trioxotetracyclo[10.2.1.02,11.04,9]pentadec-6-ene-4-carboxylate |
|---|---|
| PubChem CID | 54243925 |
| Molecular Formula | C19H22O5 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | methyl (1R,5R,8S,12R)-5,8-dimethyl-3,10,13-trioxotetracyclo[10.2.1.02,11.04,9]pentadec-6-ene-4-carboxylate |
| SMILES | COC(=O)C12C(=O)C3C(C(=O)C1[C@@H](C)C=C[C@H]2C)[C@H]1C[C@@H]3CC1=O |
| InChI | InChI=1S/C19H22O5/c1-8-4-5-9(2)19(18(23)24-3)15(8)16(21)14-11-6-10(7-12(11)20)13(14)17(19)22/h4-5,8-11,13-15H,6-7H2,1-3H3/t8-,9+,10+,11-,13?,14?,15?,19?/m0/s1 |
| InChIKey | QRXOZBTYYRUWDS-FKHCXWDTSA-N |
| XLogP | 1.60 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|