C19H24O4 — CID 54458575
methyl (1R,5R,8S,12S)-10-hydroxy-5,8-dimethyl-3-oxotetracyclo[10.2.1.02,11.04,9]pentadeca-6,13-diene-4-carboxylate (PubChem CID 54458575) has the molecular formula C19H24O4 and a molecular weight of 316.40 g/mol. Its IUPAC name is methyl (1R,5R,8S,12S)-10-hydroxy-5,8-dimethyl-3-oxotetracyclo[10.2.1.02,11.04,9]pentadeca-6,13-diene-4-carboxylate.
| Compound Name | methyl (1R,5R,8S,12S)-10-hydroxy-5,8-dimethyl-3-oxotetracyclo[10.2.1.02,11.04,9]pentadeca-6,13-diene-4-carboxylate |
|---|---|
| PubChem CID | 54458575 |
| Molecular Formula | C19H24O4 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | methyl (1R,5R,8S,12S)-10-hydroxy-5,8-dimethyl-3-oxotetracyclo[10.2.1.02,11.04,9]pentadeca-6,13-diene-4-carboxylate |
| SMILES | COC(=O)C12C(=O)C3C(C(O)C1[C@@H](C)C=C[C@H]2C)[C@@H]1C=C[C@H]3C1 |
| InChI | InChI=1S/C19H24O4/c1-9-4-5-10(2)19(18(22)23-3)15(9)16(20)13-11-6-7-12(8-11)14(13)17(19)21/h4-7,9-16,20H,8H2,1-3H3/t9-,10+,11+,12-,13?,14?,15?,16?,19?/m0/s1 |
| InChIKey | WZYSIAKKWTVJQS-KQCBYRGXSA-N |
| XLogP | 1.99 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|