C22H24O5 — CID 12605549
methyl (4S,4aR,8aR)-3-methyl-5,8-dioxo-4-(2-phenylmethoxyethyl)-4,8a-dihydro-1H-naphthalene-4a-carboxylate (PubChem CID 12605549) has the molecular formula C22H24O5 and a molecular weight of 368.43 g/mol. Its IUPAC name is methyl (4S,4aR,8aR)-3-methyl-5,8-dioxo-4-(2-phenylmethoxyethyl)-4,8a-dihydro-1H-naphthalene-4a-carboxylate.
| Compound Name | methyl (4S,4aR,8aR)-3-methyl-5,8-dioxo-4-(2-phenylmethoxyethyl)-4,8a-dihydro-1H-naphthalene-4a-carboxylate |
|---|---|
| PubChem CID | 12605549 |
| Molecular Formula | C22H24O5 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | methyl (4S,4aR,8aR)-3-methyl-5,8-dioxo-4-(2-phenylmethoxyethyl)-4,8a-dihydro-1H-naphthalene-4a-carboxylate |
| SMILES | COC(=O)[C@@]12C(=O)C=CC(=O)[C@@H]1CC=C(C)[C@@H]2CCOCc1ccccc1 |
| InChI | InChI=1S/C22H24O5/c1-15-8-9-18-19(23)10-11-20(24)22(18,21(25)26-2)17(15)12-13-27-14-16-6-4-3-5-7-16/h3-8,10-11,17-18H,9,12-14H2,1-2H3/t17-,18-,22+/m0/s1 |
| InChIKey | XTORRYPZUOPPHN-NPPFBWRTSA-N |
| XLogP | 3.04 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|