C8H7FO3 — CID 20715396
methyl 6-fluoro-4-oxobicyclo[3.1.0]hex-2-ene-6-carboxylate (PubChem CID 20715396) has the molecular formula C8H7FO3 and a molecular weight of 170.14 g/mol. Its IUPAC name is methyl 6-fluoro-4-oxobicyclo[3.1.0]hex-2-ene-6-carboxylate.
| Compound Name | methyl 6-fluoro-4-oxobicyclo[3.1.0]hex-2-ene-6-carboxylate |
|---|---|
| PubChem CID | 20715396 |
| Molecular Formula | C8H7FO3 |
| Molecular Weight | 170.14 g/mol |
| Exact Mass | 170.04 |
| IUPAC Name | methyl 6-fluoro-4-oxobicyclo[3.1.0]hex-2-ene-6-carboxylate |
| SMILES | COC(=O)C1(F)C2C=CC(=O)C21 |
| InChI | InChI=1S/C8H7FO3/c1-12-7(11)8(9)4-2-3-5(10)6(4)8/h2-4,6H,1H3 |
| InChIKey | YUVDXBOGUSXEOA-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.14 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |