C9H10O2 — CID 72814704
4-hydroxy-4-methyl-3a,6a-dihydropentalen-1-one (PubChem CID 72814704) has the molecular formula C9H10O2 and a molecular weight of 150.18 g/mol. Its IUPAC name is 4-hydroxy-4-methyl-3a,6a-dihydropentalen-1-one.
| Compound Name | 4-hydroxy-4-methyl-3a,6a-dihydropentalen-1-one |
|---|---|
| PubChem CID | 72814704 |
| Molecular Formula | C9H10O2 |
| Molecular Weight | 150.18 g/mol |
| Exact Mass | 150.07 |
| IUPAC Name | 4-hydroxy-4-methyl-3a,6a-dihydropentalen-1-one |
| SMILES | CC1(O)C=CC2C(=O)C=CC21 |
| InChI | InChI=1S/C9H10O2/c1-9(11)5-4-6-7(9)2-3-8(6)10/h2-7,11H,1H3 |
| InChIKey | OUHPNGOGIOWYAS-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.18 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|