C10H12O3 — CID 11389748
(3'aR,6'aR)-spiro[1,3-dioxolane-2,4'-3a,5,6,6a-tetrahydropentalene]-1'-one (PubChem CID 11389748) has the molecular formula C10H12O3 and a molecular weight of 180.20 g/mol. Its IUPAC name is (3'aR,6'aR)-spiro[1,3-dioxolane-2,4'-3a,5,6,6a-tetrahydropentalene]-1'-one.
| Compound Name | (3'aR,6'aR)-spiro[1,3-dioxolane-2,4'-3a,5,6,6a-tetrahydropentalene]-1'-one |
|---|---|
| PubChem CID | 11389748 |
| Molecular Formula | C10H12O3 |
| Molecular Weight | 180.20 g/mol |
| Exact Mass | 180.08 |
| IUPAC Name | (3'aR,6'aR)-spiro[1,3-dioxolane-2,4'-3a,5,6,6a-tetrahydropentalene]-1'-one |
| SMILES | O=C1C=C[C@@H]2[C@H]1CCC21OCCO1 |
| InChI | InChI=1S/C10H12O3/c11-9-2-1-8-7(9)3-4-10(8)12-5-6-13-10/h1-2,7-8H,3-6H2/t7-,8-/m1/s1 |
| InChIKey | QQRGWXNCEKMFDT-HTQZYQBOSA-N |
| XLogP | 0.89 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.20 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |