C13H18O4 — CID 53355432
(1'S,3'S,5'R,9'S)-spiro[1,3-dioxolane-2,8'-4-oxatricyclo[7.3.0.03,5]dodecane]-10'-one (PubChem CID 53355432) has the molecular formula C13H18O4 and a molecular weight of 238.28 g/mol. Its IUPAC name is (1'S,3'S,5'R,9'S)-spiro[1,3-dioxolane-2,8'-4-oxatricyclo[7.3.0.03,5]dodecane]-10'-one.
| Compound Name | (1'S,3'S,5'R,9'S)-spiro[1,3-dioxolane-2,8'-4-oxatricyclo[7.3.0.03,5]dodecane]-10'-one |
|---|---|
| PubChem CID | 53355432 |
| Molecular Formula | C13H18O4 |
| Molecular Weight | 238.28 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | (1'S,3'S,5'R,9'S)-spiro[1,3-dioxolane-2,8'-4-oxatricyclo[7.3.0.03,5]dodecane]-10'-one |
| SMILES | O=C1CC[C@H]2C[C@@H]3O[C@@H]3CCC3(OCCO3)[C@H]12 |
| InChI | InChI=1S/C13H18O4/c14-9-2-1-8-7-11-10(17-11)3-4-13(12(8)9)15-5-6-16-13/h8,10-12H,1-7H2/t8-,10+,11-,12-/m0/s1 |
| InChIKey | ONADEDHEEZQATC-IELRGYKMSA-N |
| XLogP | 1.28 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.28 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|