C16H24O3 — CID 154980483
5'-(7-oxabicyclo[4.1.0]heptan-3-yl)spiro[7-oxabicyclo[4.1.0]heptane-3,2'-oxane] (PubChem CID 154980483) has the molecular formula C16H24O3 and a molecular weight of 264.36 g/mol. Its IUPAC name is 5'-(7-oxabicyclo[4.1.0]heptan-3-yl)spiro[7-oxabicyclo[4.1.0]heptane-3,2'-oxane].
| Compound Name | 5'-(7-oxabicyclo[4.1.0]heptan-3-yl)spiro[7-oxabicyclo[4.1.0]heptane-3,2'-oxane] |
|---|---|
| PubChem CID | 154980483 |
| Molecular Formula | C16H24O3 |
| Molecular Weight | 264.36 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | 5'-(7-oxabicyclo[4.1.0]heptan-3-yl)spiro[7-oxabicyclo[4.1.0]heptane-3,2'-oxane] |
| SMILES | C1CC2(CCC3OC3C2)OCC1C1CCC2OC2C1 |
| InChI | InChI=1S/C16H24O3/c1-2-12-14(18-12)7-10(1)11-3-5-16(17-9-11)6-4-13-15(8-16)19-13/h10-15H,1-9H2 |
| InChIKey | MJIJKXCYSNSBED-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 34.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.36 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|