C11H16O4 — CID 11310383
(3'aR,6'S,7'aS)-6'-methylspiro[1,3-dioxolane-2,4'-5,6,7,7a-tetrahydro-3aH-1-benzofuran]-3'-one (PubChem CID 11310383) has the molecular formula C11H16O4 and a molecular weight of 212.24 g/mol. Its IUPAC name is (3'aR,6'S,7'aS)-6'-methylspiro[1,3-dioxolane-2,4'-5,6,7,7a-tetrahydro-3aH-1-benzofuran]-3'-one.
| Compound Name | (3'aR,6'S,7'aS)-6'-methylspiro[1,3-dioxolane-2,4'-5,6,7,7a-tetrahydro-3aH-1-benzofuran]-3'-one |
|---|---|
| PubChem CID | 11310383 |
| Molecular Formula | C11H16O4 |
| Molecular Weight | 212.24 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | (3'aR,6'S,7'aS)-6'-methylspiro[1,3-dioxolane-2,4'-5,6,7,7a-tetrahydro-3aH-1-benzofuran]-3'-one |
| SMILES | C[C@H]1C[C@@H]2OCC(=O)[C@@H]2C2(C1)OCCO2 |
| InChI | InChI=1S/C11H16O4/c1-7-4-9-10(8(12)6-13-9)11(5-7)14-2-3-15-11/h7,9-10H,2-6H2,1H3/t7-,9-,10-/m0/s1 |
| InChIKey | LQVSAMWWBSXDEP-HGNGGELXSA-N |
| XLogP | 0.74 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.24 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |