C8H14O2 — CID 134922933
2-propyl-4,7-dioxaspiro[2.4]heptane (PubChem CID 134922933) has the molecular formula C8H14O2 and a molecular weight of 142.20 g/mol. Its IUPAC name is 2-propyl-4,7-dioxaspiro[2.4]heptane.
| Compound Name | 2-propyl-4,7-dioxaspiro[2.4]heptane |
|---|---|
| PubChem CID | 134922933 |
| Molecular Formula | C8H14O2 |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.10 |
| IUPAC Name | 2-propyl-4,7-dioxaspiro[2.4]heptane |
| SMILES | CCCC1CC12OCCO2 |
| InChI | InChI=1S/C8H14O2/c1-2-3-7-6-8(7)9-4-5-10-8/h7H,2-6H2,1H3 |
| InChIKey | CWJFQPYFQJHFML-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |