About 1-methyl-2-propyl-4,7-dioxaspiro[2.4]heptane
1-methyl-2-propyl-4,7-dioxaspiro[2.4]heptane (PubChem CID 90470477) has the molecular formula C9H16O2
and a molecular weight of 156.22 g/mol. Its IUPAC name is 1-methyl-2-propyl-4,7-dioxaspiro[2.4]heptane.
Molecular Properties
| Compound Name | 1-methyl-2-propyl-4,7-dioxaspiro[2.4]heptane |
| PubChem CID | 90470477 |
| Molecular Formula | C9H16O2 |
| Molecular Weight | 156.22 g/mol |
| Exact Mass | 156.12 |
| IUPAC Name | 1-methyl-2-propyl-4,7-dioxaspiro[2.4]heptane |
| SMILES | CCCC1C(C)C12OCCO2 |
| InChI | InChI=1S/C9H16O2/c1-3-4-8-7(2)9(8)10-5-6-11-9/h7-8H,3-6H2,1-2H3 |
| InChIKey | UYNCLUGVDYVORB-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.22 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-methyl-2-propyl-4,7-dioxaspiro[2.4]heptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-2-propyl-4,7-dioxaspiro[2.4]heptane?
The IUPAC name of 1-methyl-2-propyl-4,7-dioxaspiro[2.4]heptane (CID 90470477) is 1-methyl-2-propyl-4,7-dioxaspiro[2.4]heptane.
What is the SMILES notation for 1-methyl-2-propyl-4,7-dioxaspiro[2.4]heptane?
The canonical SMILES for 1-methyl-2-propyl-4,7-dioxaspiro[2.4]heptane is CCCC1C(C)C12OCCO2.
What is the InChIKey of 1-methyl-2-propyl-4,7-dioxaspiro[2.4]heptane?
The InChIKey is UYNCLUGVDYVORB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O2/c1-3-4-8-7(2)9(8)10-5-6-11-9/h7-8H,3-6H2,1-2H3.
What are the key properties of 1-methyl-2-propyl-4,7-dioxaspiro[2.4]heptane?
1-methyl-2-propyl-4,7-dioxaspiro[2.4]heptane has a molecular weight of 156.22 g/mol, XLogP of 1.80, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-2-propyl-4,7-dioxaspiro[2.4]heptane is sourced from PubChem (CID 90470477), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).