C9H16O2 — CID 90470477
1-methyl-2-propyl-4,7-dioxaspiro[2.4]heptane (PubChem CID 90470477) has the molecular formula C9H16O2 and a molecular weight of 156.22 g/mol. Its IUPAC name is 1-methyl-2-propyl-4,7-dioxaspiro[2.4]heptane.
| Compound Name | 1-methyl-2-propyl-4,7-dioxaspiro[2.4]heptane |
|---|---|
| PubChem CID | 90470477 |
| Molecular Formula | C9H16O2 |
| Molecular Weight | 156.22 g/mol |
| Exact Mass | 156.12 |
| IUPAC Name | 1-methyl-2-propyl-4,7-dioxaspiro[2.4]heptane |
| SMILES | CCCC1C(C)C12OCCO2 |
| InChI | InChI=1S/C9H16O2/c1-3-4-8-7(2)9(8)10-5-6-11-9/h7-8H,3-6H2,1-2H3 |
| InChIKey | UYNCLUGVDYVORB-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.22 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |