C11H20O2 — CID 15722713
(4S,9S)-4,9-diethyl-1,6-dioxaspiro[4.4]nonane (PubChem CID 15722713) has the molecular formula C11H20O2 and a molecular weight of 184.28 g/mol. Its IUPAC name is (4S,9S)-4,9-diethyl-1,6-dioxaspiro[4.4]nonane.
| Compound Name | (4S,9S)-4,9-diethyl-1,6-dioxaspiro[4.4]nonane |
|---|---|
| PubChem CID | 15722713 |
| Molecular Formula | C11H20O2 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.15 |
| IUPAC Name | (4S,9S)-4,9-diethyl-1,6-dioxaspiro[4.4]nonane |
| SMILES | CC[C@H]1CCOC12OCC[C@@H]2CC |
| InChI | InChI=1S/C11H20O2/c1-3-9-5-7-12-11(9)10(4-2)6-8-13-11/h9-10H,3-8H2,1-2H3/t9-,10-,11?/m0/s1 |
| InChIKey | VLEHYXKEWWWUQI-QRHSGQBVSA-N |
| XLogP | 2.58 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |