C11H20O4 — CID 11514035
(4R,5R,10R,11S)-5,11-dimethyl-1,7-dioxaspiro[5.5]undecane-4,10-diol (PubChem CID 11514035) has the molecular formula C11H20O4 and a molecular weight of 216.28 g/mol. Its IUPAC name is (4R,5R,10R,11S)-5,11-dimethyl-1,7-dioxaspiro[5.5]undecane-4,10-diol.
| Compound Name | (4R,5R,10R,11S)-5,11-dimethyl-1,7-dioxaspiro[5.5]undecane-4,10-diol |
|---|---|
| PubChem CID | 11514035 |
| Molecular Formula | C11H20O4 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.14 |
| IUPAC Name | (4R,5R,10R,11S)-5,11-dimethyl-1,7-dioxaspiro[5.5]undecane-4,10-diol |
| SMILES | C[C@@H]1[C@H](O)CCOC12OCC[C@@H](O)[C@@H]2C |
| InChI | InChI=1S/C11H20O4/c1-7-9(12)3-5-14-11(7)8(2)10(13)4-6-15-11/h7-10,12-13H,3-6H2,1-2H3/t7-,8+,9-,10-,11?/m1/s1 |
| InChIKey | YEYSFERXUCHUAO-SJWJCTCFSA-N |
| XLogP | 0.52 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |