C13H24O4 — CID 10705457
(3R,4R,5S,6R,10R)-3,5,11,11-tetramethyl-1,7-dioxaspiro[5.5]undecane-4,10-diol (PubChem CID 10705457) has the molecular formula C13H24O4 and a molecular weight of 244.33 g/mol. Its IUPAC name is (3R,4R,5S,6R,10R)-3,5,11,11-tetramethyl-1,7-dioxaspiro[5.5]undecane-4,10-diol.
| Compound Name | (3R,4R,5S,6R,10R)-3,5,11,11-tetramethyl-1,7-dioxaspiro[5.5]undecane-4,10-diol |
|---|---|
| PubChem CID | 10705457 |
| Molecular Formula | C13H24O4 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.17 |
| IUPAC Name | (3R,4R,5S,6R,10R)-3,5,11,11-tetramethyl-1,7-dioxaspiro[5.5]undecane-4,10-diol |
| SMILES | C[C@@H]1CO[C@]2(OCC[C@@H](O)C2(C)C)[C@@H](C)[C@@H]1O |
| InChI | InChI=1S/C13H24O4/c1-8-7-17-13(9(2)11(8)15)12(3,4)10(14)5-6-16-13/h8-11,14-15H,5-7H2,1-4H3/t8-,9+,10-,11-,13-/m1/s1 |
| InChIKey | ITVPUJJAMOUTIX-UYNYGYNWSA-N |
| XLogP | 1.15 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |