C15H22O3 — CID 10868719
(1'R,2'R,6'S,7'S)-1',10'-dimethylspiro[1,3-dioxolane-2,11'-tricyclo[5.2.2.02,6]undec-8-ene]-3'-ol (PubChem CID 10868719) has the molecular formula C15H22O3 and a molecular weight of 250.34 g/mol. Its IUPAC name is (1'R,2'R,6'S,7'S)-1',10'-dimethylspiro[1,3-dioxolane-2,11'-tricyclo[5.2.2.02,6]undec-8-ene]-3'-ol.
| Compound Name | (1'R,2'R,6'S,7'S)-1',10'-dimethylspiro[1,3-dioxolane-2,11'-tricyclo[5.2.2.02,6]undec-8-ene]-3'-ol |
|---|---|
| PubChem CID | 10868719 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | (1'R,2'R,6'S,7'S)-1',10'-dimethylspiro[1,3-dioxolane-2,11'-tricyclo[5.2.2.02,6]undec-8-ene]-3'-ol |
| SMILES | CC1C2(OCCO2)[C@H]2C=C[C@]1(C)[C@@H]1C(O)CC[C@@H]12 |
| InChI | InChI=1S/C15H22O3/c1-9-14(2)6-5-11(15(9)17-7-8-18-15)10-3-4-12(16)13(10)14/h5-6,9-13,16H,3-4,7-8H2,1-2H3/t9?,10-,11+,12?,13+,14+/m1/s1 |
| InChIKey | SRULGEFIAXXHHZ-JUFKBSLCSA-N |
| XLogP | 1.96 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|