C14H18O3 — CID 146029301
(1'R,5'S,6'S,7'S,8'S,9'R,10'S)-8'-methylspiro[1,3-dioxolane-2,11'-pentacyclo[5.4.0.02,6.03,10.05,9]undecane]-8'-ol (PubChem CID 146029301) has the molecular formula C14H18O3 and a molecular weight of 234.29 g/mol. Its IUPAC name is (1'R,5'S,6'S,7'S,8'S,9'R,10'S)-8'-methylspiro[1,3-dioxolane-2,11'-pentacyclo[5.4.0.02,6.03,10.05,9]undecane]-8'-ol.
| Compound Name | (1'R,5'S,6'S,7'S,8'S,9'R,10'S)-8'-methylspiro[1,3-dioxolane-2,11'-pentacyclo[5.4.0.02,6.03,10.05,9]undecane]-8'-ol |
|---|---|
| PubChem CID | 146029301 |
| Molecular Formula | C14H18O3 |
| Molecular Weight | 234.29 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | (1'R,5'S,6'S,7'S,8'S,9'R,10'S)-8'-methylspiro[1,3-dioxolane-2,11'-pentacyclo[5.4.0.02,6.03,10.05,9]undecane]-8'-ol |
| SMILES | C[C@]1(O)[C@@H]2[C@H]3CC4C5[C@H]3[C@H]1[C@@H]5C1(OCCO1)[C@@H]42 |
| InChI | InChI=1S/C14H18O3/c1-13(15)9-5-4-6-8-7(5)11(13)12(8)14(10(6)9)16-2-3-17-14/h5-12,15H,2-4H2,1H3/t5-,6?,7-,8?,9+,10-,11-,12+,13-/m0/s1 |
| InChIKey | HKJIFTUVVWBTBF-SYOCONDMSA-N |
| XLogP | 0.87 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.29 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |