C12H16O2 — CID 124807375
(1R,2R,3R,4R,5S,6R,7S,8S,9S,10S)-6,10-dimethylpentacyclo[5.3.0.02,5.03,9.04,8]decane-6,10-diol (PubChem CID 124807375) has the molecular formula C12H16O2 and a molecular weight of 192.26 g/mol. Its IUPAC name is (1R,2R,3R,4R,5S,6R,7S,8S,9S,10S)-6,10-dimethylpentacyclo[5.3.0.02,5.03,9.04,8]decane-6,10-diol.
| Compound Name | (1R,2R,3R,4R,5S,6R,7S,8S,9S,10S)-6,10-dimethylpentacyclo[5.3.0.02,5.03,9.04,8]decane-6,10-diol |
|---|---|
| PubChem CID | 124807375 |
| Molecular Formula | C12H16O2 |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.12 |
| IUPAC Name | (1R,2R,3R,4R,5S,6R,7S,8S,9S,10S)-6,10-dimethylpentacyclo[5.3.0.02,5.03,9.04,8]decane-6,10-diol |
| SMILES | C[C@]1(O)[C@H]2[C@@H]3[C@@H]4[C@@H]2[C@H]2[C@H]1[C@H]3[C@H]4[C@@]2(C)O |
| InChI | InChI=1S/C12H16O2/c1-11(13)7-3-4-5(7)10-9(11)6(3)8(4)12(10,2)14/h3-10,13-14H,1-2H3/t3-,4-,5-,6+,7+,8+,9+,10-,11-,12+/m1/s1 |
| InChIKey | IJZYUZHMQPAATI-COZRNNPFSA-N |
| XLogP | 0.49 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |