C12H26N2O4 — CID 20589297
3,6-diamino-1,2,3,4,5,6-hexamethylcyclohexane-1,2,4,5-tetrol (PubChem CID 20589297) has the molecular formula C12H26N2O4 and a molecular weight of 262.35 g/mol. Its IUPAC name is 3,6-diamino-1,2,3,4,5,6-hexamethylcyclohexane-1,2,4,5-tetrol.
| Compound Name | 3,6-diamino-1,2,3,4,5,6-hexamethylcyclohexane-1,2,4,5-tetrol |
|---|---|
| PubChem CID | 20589297 |
| Molecular Formula | C12H26N2O4 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.19 |
| IUPAC Name | 3,6-diamino-1,2,3,4,5,6-hexamethylcyclohexane-1,2,4,5-tetrol |
| SMILES | CC1(N)C(C)(O)C(C)(O)C(C)(N)C(C)(O)C1(C)O |
| InChI | InChI=1S/C12H26N2O4/c1-7(13)9(3,15)11(5,17)8(2,14)12(6,18)10(7,4)16/h15-18H,13-14H2,1-6H3 |
| InChIKey | WFDSLCOLHSXHPM-UHFFFAOYSA-N |
| XLogP | -1.56 |
| TPSA | 132.96 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | -1.56 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |