C8H21N5O5 — CID 123691183
2,3,4,5,7-pentaamino-6-(hydroxymethyl)-2-methyloxepane-3,4,5-triol (PubChem CID 123691183) has the molecular formula C8H21N5O5 and a molecular weight of 267.29 g/mol. Its IUPAC name is 2,3,4,5,7-pentaamino-6-(hydroxymethyl)-2-methyloxepane-3,4,5-triol.
| Compound Name | 2,3,4,5,7-pentaamino-6-(hydroxymethyl)-2-methyloxepane-3,4,5-triol |
|---|---|
| PubChem CID | 123691183 |
| Molecular Formula | C8H21N5O5 |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | 2,3,4,5,7-pentaamino-6-(hydroxymethyl)-2-methyloxepane-3,4,5-triol |
| SMILES | CC1(N)OC(N)C(CO)C(N)(O)C(N)(O)C1(N)O |
| InChI | InChI=1S/C8H21N5O5/c1-5(10)7(12,16)8(13,17)6(11,15)3(2-14)4(9)18-5/h3-4,14-17H,2,9-13H2,1H3 |
| InChIKey | SYULIWVZLNFCQS-UHFFFAOYSA-N |
| XLogP | -5.47 |
| TPSA | 220.25 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | -5.47 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|