About [3-(hydroxymethyl)-2,2-dimethylcyclopropyl]methanol
[3-(hydroxymethyl)-2,2-dimethylcyclopropyl]methanol (PubChem CID 14320848) has the molecular formula C7H14O2
and a molecular weight of 130.19 g/mol. Its IUPAC name is [3-(hydroxymethyl)-2,2-dimethylcyclopropyl]methanol.
Analyze [3-(hydroxymethyl)-2,2-dimethylcyclopropyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(hydroxymethyl)-2,2-dimethylcyclopropyl]methanol?
The IUPAC name of [3-(hydroxymethyl)-2,2-dimethylcyclopropyl]methanol (CID 14320848) is [3-(hydroxymethyl)-2,2-dimethylcyclopropyl]methanol.
What is the SMILES notation for [3-(hydroxymethyl)-2,2-dimethylcyclopropyl]methanol?
The canonical SMILES for [3-(hydroxymethyl)-2,2-dimethylcyclopropyl]methanol is CC1(C)C(CO)C1CO.
What is the InChIKey of [3-(hydroxymethyl)-2,2-dimethylcyclopropyl]methanol?
The InChIKey is YTFDQYUOJBRVIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14O2/c1-7(2)5(3-8)6(7)4-9/h5-6,8-9H,3-4H2,1-2H3.
What are the key properties of [3-(hydroxymethyl)-2,2-dimethylcyclopropyl]methanol?
[3-(hydroxymethyl)-2,2-dimethylcyclopropyl]methanol has a molecular weight of 130.19 g/mol, XLogP of 0.24, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(hydroxymethyl)-2,2-dimethylcyclopropyl]methanol is sourced from PubChem (CID 14320848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).