C10H14OS — CID 130488950
(2,2-dimethyl-3-thiophen-3-ylcyclopropyl)methanol (PubChem CID 130488950) has the molecular formula C10H14OS and a molecular weight of 182.29 g/mol. Its IUPAC name is (2,2-dimethyl-3-thiophen-3-ylcyclopropyl)methanol.
| Compound Name | (2,2-dimethyl-3-thiophen-3-ylcyclopropyl)methanol |
|---|---|
| PubChem CID | 130488950 |
| Molecular Formula | C10H14OS |
| Molecular Weight | 182.29 g/mol |
| Exact Mass | 182.08 |
| IUPAC Name | (2,2-dimethyl-3-thiophen-3-ylcyclopropyl)methanol |
| SMILES | CC1(C)C(CO)C1c1ccsc1 |
| InChI | InChI=1S/C10H14OS/c1-10(2)8(5-11)9(10)7-3-4-12-6-7/h3-4,6,8-9,11H,5H2,1-2H3 |
| InChIKey | QUFQHOCAMLSDKD-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.29 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |