C10H14O2S — CID 130584230
(5-methyl-5-thiophen-3-yloxolan-2-yl)methanol (PubChem CID 130584230) has the molecular formula C10H14O2S and a molecular weight of 198.29 g/mol. Its IUPAC name is (5-methyl-5-thiophen-3-yloxolan-2-yl)methanol.
| Compound Name | (5-methyl-5-thiophen-3-yloxolan-2-yl)methanol |
|---|---|
| PubChem CID | 130584230 |
| Molecular Formula | C10H14O2S |
| Molecular Weight | 198.29 g/mol |
| Exact Mass | 198.07 |
| IUPAC Name | (5-methyl-5-thiophen-3-yloxolan-2-yl)methanol |
| SMILES | CC1(c2ccsc2)CCC(CO)O1 |
| InChI | InChI=1S/C10H14O2S/c1-10(8-3-5-13-7-8)4-2-9(6-11)12-10/h3,5,7,9,11H,2,4,6H2,1H3 |
| InChIKey | AKIUJMKMGMXQLY-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.29 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |