About 3-(3,3,5-trimethyl-1-thiophen-3-ylcyclohexyl)thiophene
3-(3,3,5-trimethyl-1-thiophen-3-ylcyclohexyl)thiophene (PubChem CID 142418474) has the molecular formula C17H22S2
and a molecular weight of 290.50 g/mol. Its IUPAC name is 3-(3,3,5-trimethyl-1-thiophen-3-ylcyclohexyl)thiophene.
Molecular Properties
| Compound Name | 3-(3,3,5-trimethyl-1-thiophen-3-ylcyclohexyl)thiophene |
| PubChem CID | 142418474 |
| Molecular Formula | C17H22S2 |
| Molecular Weight | 290.50 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | 3-(3,3,5-trimethyl-1-thiophen-3-ylcyclohexyl)thiophene |
| SMILES | CC1CC(C)(C)CC(c2ccsc2)(c2ccsc2)C1 |
| InChI | InChI=1S/C17H22S2/c1-13-8-16(2,3)12-17(9-13,14-4-6-18-10-14)15-5-7-19-11-15/h4-7,10-11,13H,8-9,12H2,1-3H3 |
| InChIKey | STXIDYYECLCZPE-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 290.50 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(3,3,5-trimethyl-1-thiophen-3-ylcyclohexyl)thiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,3,5-trimethyl-1-thiophen-3-ylcyclohexyl)thiophene?
The IUPAC name of 3-(3,3,5-trimethyl-1-thiophen-3-ylcyclohexyl)thiophene (CID 142418474) is 3-(3,3,5-trimethyl-1-thiophen-3-ylcyclohexyl)thiophene.
What is the SMILES notation for 3-(3,3,5-trimethyl-1-thiophen-3-ylcyclohexyl)thiophene?
The canonical SMILES for 3-(3,3,5-trimethyl-1-thiophen-3-ylcyclohexyl)thiophene is CC1CC(C)(C)CC(c2ccsc2)(c2ccsc2)C1.
What is the InChIKey of 3-(3,3,5-trimethyl-1-thiophen-3-ylcyclohexyl)thiophene?
The InChIKey is STXIDYYECLCZPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22S2/c1-13-8-16(2,3)12-17(9-13,14-4-6-18-10-14)15-5-7-19-11-15/h4-7,10-11,13H,8-9,12H2,1-3H3.
What are the key properties of 3-(3,3,5-trimethyl-1-thiophen-3-ylcyclohexyl)thiophene?
3-(3,3,5-trimethyl-1-thiophen-3-ylcyclohexyl)thiophene has a molecular weight of 290.50 g/mol, XLogP of 5.94, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,3,5-trimethyl-1-thiophen-3-ylcyclohexyl)thiophene is sourced from PubChem (CID 142418474), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).