C15H20F3NO2 — CID 90073914
2-[[(2R,5S)-5-methyl-5-[4-(trifluoromethyl)phenyl]oxolan-2-yl]methylamino]ethanol (PubChem CID 90073914) has the molecular formula C15H20F3NO2 and a molecular weight of 303.32 g/mol. Its IUPAC name is 2-[[(2R,5S)-5-methyl-5-[4-(trifluoromethyl)phenyl]oxolan-2-yl]methylamino]ethanol.
| Compound Name | 2-[[(2R,5S)-5-methyl-5-[4-(trifluoromethyl)phenyl]oxolan-2-yl]methylamino]ethanol |
|---|---|
| PubChem CID | 90073914 |
| Molecular Formula | C15H20F3NO2 |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | 2-[[(2R,5S)-5-methyl-5-[4-(trifluoromethyl)phenyl]oxolan-2-yl]methylamino]ethanol |
| SMILES | C[C@@]1(c2ccc(C(F)(F)F)cc2)CC[C@H](CNCCO)O1 |
| InChI | InChI=1S/C15H20F3NO2/c1-14(7-6-13(21-14)10-19-8-9-20)11-2-4-12(5-3-11)15(16,17)18/h2-5,13,19-20H,6-10H2,1H3/t13-,14+/m1/s1 |
| InChIKey | OMPZUPPVWOFOOF-KGLIPLIRSA-N |
| XLogP | 2.68 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|