C21H36ClNO2 — CID 72704523
(2R,4S)-2-(methoxymethyl)-4-[(4-octylphenyl)methoxy]pyrrolidine;hydrochloride (PubChem CID 72704523) has the molecular formula C21H36ClNO2 and a molecular weight of 369.98 g/mol. Its IUPAC name is (2R,4S)-2-(methoxymethyl)-4-[(4-octylphenyl)methoxy]pyrrolidine;hydrochloride.
| Compound Name | (2R,4S)-2-(methoxymethyl)-4-[(4-octylphenyl)methoxy]pyrrolidine;hydrochloride |
|---|---|
| PubChem CID | 72704523 |
| Molecular Formula | C21H36ClNO2 |
| Molecular Weight | 369.98 g/mol |
| Exact Mass | 369.24 |
| IUPAC Name | (2R,4S)-2-(methoxymethyl)-4-[(4-octylphenyl)methoxy]pyrrolidine;hydrochloride |
| SMILES | CCCCCCCCc1ccc(CO[C@@H]2CN[C@@H](COC)C2)cc1.Cl |
| InChI | InChI=1S/C21H35NO2.ClH/c1-3-4-5-6-7-8-9-18-10-12-19(13-11-18)16-24-21-14-20(17-23-2)22-15-21;/h10-13,20-22H,3-9,14-17H2,1-2H3;1H/t20-,21+;/m1./s1 |
| InChIKey | OUNZRMDTWMVCNZ-BHDTVMLSSA-N |
| XLogP | 4.90 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.98 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|