C16H18O6S2 — CID 68974006
(1R,2R,4S)-2-[(1R)-1,2-dihydroxyethyl]-3,6-di(thiophen-3-yl)bicyclo[2.2.0]hexane-1,2,4,5-tetrol (PubChem CID 68974006) has the molecular formula C16H18O6S2 and a molecular weight of 370.45 g/mol. Its IUPAC name is (1R,2R,4S)-2-[(1R)-1,2-dihydroxyethyl]-3,6-di(thiophen-3-yl)bicyclo[2.2.0]hexane-1,2,4,5-tetrol.
| Compound Name | (1R,2R,4S)-2-[(1R)-1,2-dihydroxyethyl]-3,6-di(thiophen-3-yl)bicyclo[2.2.0]hexane-1,2,4,5-tetrol |
|---|---|
| PubChem CID | 68974006 |
| Molecular Formula | C16H18O6S2 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.05 |
| IUPAC Name | (1R,2R,4S)-2-[(1R)-1,2-dihydroxyethyl]-3,6-di(thiophen-3-yl)bicyclo[2.2.0]hexane-1,2,4,5-tetrol |
| SMILES | OC[C@@H](O)[C@]1(O)C(c2ccsc2)[C@]2(O)C(O)C(c3ccsc3)[C@@]21O |
| InChI | InChI=1S/C16H18O6S2/c17-5-10(18)14(20)12(9-2-4-24-7-9)15(21)13(19)11(16(14,15)22)8-1-3-23-6-8/h1-4,6-7,10-13,17-22H,5H2/t10-,11?,12?,13?,14+,15+,16+/m1/s1 |
| InChIKey | HVARSKMDWCUZOH-AFWVLNJPSA-N |
| XLogP | -0.39 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |