C10H14O5S — CID 102451889
(2R,3S,4R,5R,6S)-2-(hydroxymethyl)-6-thiophen-3-yloxane-3,4,5-triol (PubChem CID 102451889) has the molecular formula C10H14O5S and a molecular weight of 246.28 g/mol. Its IUPAC name is (2R,3S,4R,5R,6S)-2-(hydroxymethyl)-6-thiophen-3-yloxane-3,4,5-triol.
| Compound Name | (2R,3S,4R,5R,6S)-2-(hydroxymethyl)-6-thiophen-3-yloxane-3,4,5-triol |
|---|---|
| PubChem CID | 102451889 |
| Molecular Formula | C10H14O5S |
| Molecular Weight | 246.28 g/mol |
| Exact Mass | 246.06 |
| IUPAC Name | (2R,3S,4R,5R,6S)-2-(hydroxymethyl)-6-thiophen-3-yloxane-3,4,5-triol |
| SMILES | OC[C@H]1O[C@@H](c2ccsc2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C10H14O5S/c11-3-6-7(12)8(13)9(14)10(15-6)5-1-2-16-4-5/h1-2,4,6-14H,3H2/t6-,7-,8+,9-,10+/m1/s1 |
| InChIKey | KTHKGSOTDOVICY-SPFKKGSWSA-N |
| XLogP | -0.74 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.28 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |