C21H25NO5S2 — CID 54770401
(2R,3S,4R,5R,6S)-2-(hydroxymethyl)-6-[4-methyl-3-[(5-thiophen-3-yl-4H-1,3-thiazol-5-yl)methyl]phenyl]oxane-3,4,5-triol (PubChem CID 54770401) has the molecular formula C21H25NO5S2 and a molecular weight of 435.57 g/mol. Its IUPAC name is (2R,3S,4R,5R,6S)-2-(hydroxymethyl)-6-[4-methyl-3-[(5-thiophen-3-yl-4H-1,3-thiazol-5-yl)methyl]phenyl]oxane-3,4,5-triol.
| Compound Name | (2R,3S,4R,5R,6S)-2-(hydroxymethyl)-6-[4-methyl-3-[(5-thiophen-3-yl-4H-1,3-thiazol-5-yl)methyl]phenyl]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 54770401 |
| Molecular Formula | C21H25NO5S2 |
| Molecular Weight | 435.57 g/mol |
| Exact Mass | 435.12 |
| IUPAC Name | (2R,3S,4R,5R,6S)-2-(hydroxymethyl)-6-[4-methyl-3-[(5-thiophen-3-yl-4H-1,3-thiazol-5-yl)methyl]phenyl]oxane-3,4,5-triol |
| SMILES | Cc1ccc([C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)cc1CC1(c2ccsc2)CN=CS1 |
| InChI | InChI=1S/C21H25NO5S2/c1-12-2-3-13(20-19(26)18(25)17(24)16(8-23)27-20)6-14(12)7-21(10-22-11-29-21)15-4-5-28-9-15/h2-6,9,11,16-20,23-26H,7-8,10H2,1H3/t16-,17-,18+,19-,20+,21?/m1/s1 |
| InChIKey | LHAYLAGWRHYDIN-IPEKBPMVSA-N |
| XLogP | 1.78 |
| TPSA | 102.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.57 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |