C23H24FNO5S — CID 11201648
(2S,3R,4R,5S,6R)-2-[3-[[5-(6-fluoro-2-pyridinyl)thiophen-2-yl]methyl]-4-methylphenyl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 11201648) has the molecular formula C23H24FNO5S and a molecular weight of 445.51 g/mol. Its IUPAC name is (2S,3R,4R,5S,6R)-2-[3-[[5-(6-fluoro-2-pyridinyl)thiophen-2-yl]methyl]-4-methylphenyl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4R,5S,6R)-2-[3-[[5-(6-fluoro-2-pyridinyl)thiophen-2-yl]methyl]-4-methylphenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 11201648 |
| Molecular Formula | C23H24FNO5S |
| Molecular Weight | 445.51 g/mol |
| Exact Mass | 445.14 |
| IUPAC Name | (2S,3R,4R,5S,6R)-2-[3-[[5-(6-fluoro-2-pyridinyl)thiophen-2-yl]methyl]-4-methylphenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | Cc1ccc([C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)C2O)cc1Cc1ccc(-c2cccc(F)n2)s1 |
| InChI | InChI=1S/C23H24FNO5S/c1-12-5-6-13(23-22(29)21(28)20(27)17(11-26)30-23)9-14(12)10-15-7-8-18(31-15)16-3-2-4-19(24)25-16/h2-9,17,20-23,26-29H,10-11H2,1H3/t17-,20-,21+,22?,23+/m1/s1 |
| InChIKey | KVGGOLXDOKXGAG-YCXFTDOWSA-N |
| XLogP | 2.36 |
| TPSA | 103.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.51 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|