C24H22FNO5S — CID 67086059
3-[5-[[2-fluoro-5-[(3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]phenyl]methyl]thiophen-2-yl]benzonitrile (PubChem CID 67086059) has the molecular formula C24H22FNO5S and a molecular weight of 455.51 g/mol. Its IUPAC name is 3-[5-[[2-fluoro-5-[(3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]phenyl]methyl]thiophen-2-yl]benzonitrile.
| Compound Name | 3-[5-[[2-fluoro-5-[(3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]phenyl]methyl]thiophen-2-yl]benzonitrile |
|---|---|
| PubChem CID | 67086059 |
| Molecular Formula | C24H22FNO5S |
| Molecular Weight | 455.51 g/mol |
| Exact Mass | 455.12 |
| IUPAC Name | 3-[5-[[2-fluoro-5-[(3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]phenyl]methyl]thiophen-2-yl]benzonitrile |
| SMILES | N#Cc1cccc(-c2ccc(Cc3cc(C4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O)ccc3F)s2)c1 |
| InChI | InChI=1S/C24H22FNO5S/c25-18-6-4-15(24-23(30)22(29)21(28)19(12-27)31-24)9-16(18)10-17-5-7-20(32-17)14-3-1-2-13(8-14)11-26/h1-9,19,21-24,27-30H,10,12H2/t19-,21-,22+,23-,24?/m1/s1 |
| InChIKey | MKHWXXKLPZNAHO-KKEQRHKBSA-N |
| XLogP | 2.53 |
| TPSA | 113.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.51 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |