C23H20F4O5S — CID 163935148
(2S,3R,4R,5S,6R)-2-[3-[difluoro-[5-(4-fluorophenyl)thiophen-2-yl]methyl]-4-fluorophenyl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 163935148) has the molecular formula C23H20F4O5S and a molecular weight of 484.47 g/mol. Its IUPAC name is (2S,3R,4R,5S,6R)-2-[3-[difluoro-[5-(4-fluorophenyl)thiophen-2-yl]methyl]-4-fluorophenyl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4R,5S,6R)-2-[3-[difluoro-[5-(4-fluorophenyl)thiophen-2-yl]methyl]-4-fluorophenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 163935148 |
| Molecular Formula | C23H20F4O5S |
| Molecular Weight | 484.47 g/mol |
| Exact Mass | 484.10 |
| IUPAC Name | (2S,3R,4R,5S,6R)-2-[3-[difluoro-[5-(4-fluorophenyl)thiophen-2-yl]methyl]-4-fluorophenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | OC[C@H]1O[C@@H](c2ccc(F)c(C(F)(F)c3ccc(-c4ccc(F)cc4)s3)c2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C23H20F4O5S/c24-13-4-1-11(2-5-13)17-7-8-18(33-17)23(26,27)14-9-12(3-6-15(14)25)22-21(31)20(30)19(29)16(10-28)32-22/h1-9,16,19-22,28-31H,10H2/t16-,19-,20+,21-,22+/m1/s1 |
| InChIKey | RMCJLNVUAHMSGG-OSKXVONFSA-N |
| XLogP | 3.35 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.47 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |