C21H25NO5S — CID 155176682
(3R,5S)-2-[3-(6,7-dihydro-1,3-benzothiazol-2-ylmethyl)-4-methylphenyl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 155176682) has the molecular formula C21H25NO5S and a molecular weight of 403.50 g/mol. Its IUPAC name is (3R,5S)-2-[3-(6,7-dihydro-1,3-benzothiazol-2-ylmethyl)-4-methylphenyl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (3R,5S)-2-[3-(6,7-dihydro-1,3-benzothiazol-2-ylmethyl)-4-methylphenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 155176682 |
| Molecular Formula | C21H25NO5S |
| Molecular Weight | 403.50 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | (3R,5S)-2-[3-(6,7-dihydro-1,3-benzothiazol-2-ylmethyl)-4-methylphenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | Cc1ccc(C2OC(CO)[C@@H](O)C(O)[C@H]2O)cc1Cc1nc2c(s1)CCC=C2 |
| InChI | InChI=1S/C21H25NO5S/c1-11-6-7-12(21-20(26)19(25)18(24)15(10-23)27-21)8-13(11)9-17-22-14-4-2-3-5-16(14)28-17/h2,4,6-8,15,18-21,23-26H,3,5,9-10H2,1H3/t15?,18-,19?,20-,21?/m1/s1 |
| InChIKey | MJPISKIJSRSLAC-XKQOFVROSA-N |
| XLogP | 1.52 |
| TPSA | 103.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.50 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |