C15H22O5 — CID 70309923
2-(hydroxymethyl)-6-(4-propan-2-ylphenyl)oxane-3,4,5-triol (PubChem CID 70309923) has the molecular formula C15H22O5 and a molecular weight of 282.34 g/mol. Its IUPAC name is 2-(hydroxymethyl)-6-(4-propan-2-ylphenyl)oxane-3,4,5-triol.
| Compound Name | 2-(hydroxymethyl)-6-(4-propan-2-ylphenyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 70309923 |
| Molecular Formula | C15H22O5 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | 2-(hydroxymethyl)-6-(4-propan-2-ylphenyl)oxane-3,4,5-triol |
| SMILES | CC(C)c1ccc(C2OC(CO)C(O)C(O)C2O)cc1 |
| InChI | InChI=1S/C15H22O5/c1-8(2)9-3-5-10(6-4-9)15-14(19)13(18)12(17)11(7-16)20-15/h3-6,8,11-19H,7H2,1-2H3 |
| InChIKey | WWEHXQFGQDSLQH-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |