C24H32ClNO6 — CID 123452699
2-[4-chloro-3-[[4-[1-(methoxyamino)-2-methylpropyl]phenyl]methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 123452699) has the molecular formula C24H32ClNO6 and a molecular weight of 465.97 g/mol. Its IUPAC name is 2-[4-chloro-3-[[4-[1-(methoxyamino)-2-methylpropyl]phenyl]methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | 2-[4-chloro-3-[[4-[1-(methoxyamino)-2-methylpropyl]phenyl]methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 123452699 |
| Molecular Formula | C24H32ClNO6 |
| Molecular Weight | 465.97 g/mol |
| Exact Mass | 465.19 |
| IUPAC Name | 2-[4-chloro-3-[[4-[1-(methoxyamino)-2-methylpropyl]phenyl]methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | CONC(c1ccc(Cc2cc(C3OC(CO)C(O)C(O)C3O)ccc2Cl)cc1)C(C)C |
| InChI | InChI=1S/C24H32ClNO6/c1-13(2)20(26-31-3)15-6-4-14(5-7-15)10-17-11-16(8-9-18(17)25)24-23(30)22(29)21(28)19(12-27)32-24/h4-9,11,13,19-24,26-30H,10,12H2,1-3H3 |
| InChIKey | UQPNNZCQFUXNKN-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 111.41 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.97 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|