C11H17NOS — CID 112634022
2,2-dimethyl-3-(thiophen-3-ylmethylamino)cyclobutan-1-ol (PubChem CID 112634022) has the molecular formula C11H17NOS and a molecular weight of 211.33 g/mol. Its IUPAC name is 2,2-dimethyl-3-(thiophen-3-ylmethylamino)cyclobutan-1-ol.
| Compound Name | 2,2-dimethyl-3-(thiophen-3-ylmethylamino)cyclobutan-1-ol |
|---|---|
| PubChem CID | 112634022 |
| Molecular Formula | C11H17NOS |
| Molecular Weight | 211.33 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | 2,2-dimethyl-3-(thiophen-3-ylmethylamino)cyclobutan-1-ol |
| SMILES | CC1(C)C(O)CC1NCc1ccsc1 |
| InChI | InChI=1S/C11H17NOS/c1-11(2)9(5-10(11)13)12-6-8-3-4-14-7-8/h3-4,7,9-10,12-13H,5-6H2,1-2H3 |
| InChIKey | HKRVWXNVNDLHTP-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.33 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |